About 9H-fluoren-4-ylboronic acid
9H-fluoren-4-ylboronic acid (PubChem CID 68786516) has the molecular formula C13H11BO2
and a molecular weight of 210.04 g/mol. Its IUPAC name is 9H-fluoren-4-ylboronic acid.
Molecular Properties
| Compound Name | 9H-fluoren-4-ylboronic acid |
| PubChem CID | 68786516 |
| Molecular Formula | C13H11BO2 |
| Molecular Weight | 210.04 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 9H-fluoren-4-ylboronic acid |
| SMILES | OB(O)c1cccc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C13H11BO2/c15-14(16)12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7,15-16H,8H2 |
| InChIKey | RXOZDDLRPNZDMG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.04 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-4-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-4-ylboronic acid?
The IUPAC name of 9H-fluoren-4-ylboronic acid (CID 68786516) is 9H-fluoren-4-ylboronic acid.
What is the SMILES notation for 9H-fluoren-4-ylboronic acid?
The canonical SMILES for 9H-fluoren-4-ylboronic acid is OB(O)c1cccc2c1-c1ccccc1C2.
What is the InChIKey of 9H-fluoren-4-ylboronic acid?
The InChIKey is RXOZDDLRPNZDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BO2/c15-14(16)12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7,15-16H,8H2.
What are the key properties of 9H-fluoren-4-ylboronic acid?
9H-fluoren-4-ylboronic acid has a molecular weight of 210.04 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-4-ylboronic acid is sourced from PubChem (CID 68786516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).