C10H14FN3 — CID 68786672
3-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4H-pyridin-3-amine (PubChem CID 68786672) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is 3-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4H-pyridin-3-amine.
| Compound Name | 3-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4H-pyridin-3-amine |
|---|---|
| PubChem CID | 68786672 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 3-fluoro-2-(1,2,3,6-tetrahydropyridin-4-yl)-4H-pyridin-3-amine |
| SMILES | NC1(F)CC=CN=C1C1=CCNCC1 |
| InChI | InChI=1S/C10H14FN3/c11-10(12)4-1-5-14-9(10)8-2-6-13-7-3-8/h1-2,5,13H,3-4,6-7,12H2 |
| InChIKey | OVXTYUXXYGRTIF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|