C26H43N3O5 — CID 68786751
[(3R,5S,6R,8S)-6-hydroxy-8-(hydroxymethyl)-3-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-2,9-dimethyldecan-5-yl]carbamic acid (PubChem CID 68786751) has the molecular formula C26H43N3O5 and a molecular weight of 477.65 g/mol. Its IUPAC name is [(3R,5S,6R,8S)-6-hydroxy-8-(hydroxymethyl)-3-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-2,9-dimethyldecan-5-yl]carbamic acid.
| Compound Name | [(3R,5S,6R,8S)-6-hydroxy-8-(hydroxymethyl)-3-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-2,9-dimethyldecan-5-yl]carbamic acid |
|---|---|
| PubChem CID | 68786751 |
| Molecular Formula | C26H43N3O5 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | [(3R,5S,6R,8S)-6-hydroxy-8-(hydroxymethyl)-3-[[1-(3-methoxypropyl)indazol-6-yl]methyl]-2,9-dimethyldecan-5-yl]carbamic acid |
| SMILES | COCCCn1ncc2ccc(C[C@H](C[C@H](NC(=O)O)[C@H](O)C[C@H](CO)C(C)C)C(C)C)cc21 |
| InChI | InChI=1S/C26H43N3O5/c1-17(2)21(13-23(28-26(32)33)25(31)14-22(16-30)18(3)4)11-19-7-8-20-15-27-29(24(20)12-19)9-6-10-34-5/h7-8,12,15,17-18,21-23,25,28,30-31H,6,9-11,13-14,16H2,1-5H3,(H,32,33)/t21-,22-,23+,25-/m1/s1 |
| InChIKey | MVPHUNNXEBTVAD-AGDMDRQQSA-N |
| XLogP | 3.93 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|