About N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide
N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide (PubChem CID 68786952) has the molecular formula C23H17N3OS2
and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide.
Molecular Properties
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide |
| PubChem CID | 68786952 |
| Molecular Formula | C23H17N3OS2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide |
| SMILES | Cc1csc(NC(=O)Cc2cccc3cnccc23)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H17N3OS2/c1-14-13-28-22(21(14)23-25-18-7-2-3-8-19(18)29-23)26-20(27)11-15-5-4-6-16-12-24-10-9-17(15)16/h2-10,12-13H,11H2,1H3,(H,26,27) |
| InChIKey | RIWOUTFIUQAVSK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide?
The IUPAC name of N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide (CID 68786952) is N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide.
What is the SMILES notation for N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide?
The canonical SMILES for N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide is Cc1csc(NC(=O)Cc2cccc3cnccc23)c1-c1nc2ccccc2s1.
What is the InChIKey of N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide?
The InChIKey is RIWOUTFIUQAVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3OS2/c1-14-13-28-22(21(14)23-25-18-7-2-3-8-19(18)29-23)26-20(27)11-15-5-4-6-16-12-24-10-9-17(15)16/h2-10,12-13H,11H2,1H3,(H,26,27).
What are the key properties of N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide?
N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide has a molecular weight of 415.54 g/mol, XLogP of 6.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-benzothiazol-2-yl)-4-methylthiophen-2-yl]-2-isoquinolin-5-ylacetamide is sourced from PubChem (CID 68786952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).