About 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide
4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide (PubChem CID 68787311) has the molecular formula C27H21FN4O2
and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide.
Molecular Properties
| Compound Name | 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide |
| PubChem CID | 68787311 |
| Molecular Formula | C27H21FN4O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide |
| SMILES | Cc1c(Nc2ccc(F)cc2)cccc1-c1ccc(C(N)=O)c2[nH]c3cc(C(N)=O)ccc3c12 |
| InChI | InChI=1S/C27H21FN4O2/c1-14-18(3-2-4-22(14)31-17-8-6-16(28)7-9-17)19-11-12-21(27(30)34)25-24(19)20-10-5-15(26(29)33)13-23(20)32-25/h2-13,31-32H,1H3,(H2,29,33)(H2,30,34) |
| InChIKey | YNCPIIVXPPBXLW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide?
The IUPAC name of 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide (CID 68787311) is 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide.
What is the SMILES notation for 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide?
The canonical SMILES for 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide is Cc1c(Nc2ccc(F)cc2)cccc1-c1ccc(C(N)=O)c2[nH]c3cc(C(N)=O)ccc3c12.
What is the InChIKey of 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide?
The InChIKey is YNCPIIVXPPBXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21FN4O2/c1-14-18(3-2-4-22(14)31-17-8-6-16(28)7-9-17)19-11-12-21(27(30)34)25-24(19)20-10-5-15(26(29)33)13-23(20)32-25/h2-13,31-32H,1H3,(H2,29,33)(H2,30,34).
What are the key properties of 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide?
4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide has a molecular weight of 452.49 g/mol, XLogP of 5.38, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-fluoroanilino)-2-methylphenyl]-9H-carbazole-1,7-dicarboxamide is sourced from PubChem (CID 68787311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).