C35H33FN4O2 — CID 68787992
N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-2-(5-hydroxy-1H-indol-3-yl)acetamide (PubChem CID 68787992) has the molecular formula C35H33FN4O2 and a molecular weight of 560.67 g/mol. Its IUPAC name is N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-2-(5-hydroxy-1H-indol-3-yl)acetamide.
| Compound Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-2-(5-hydroxy-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 68787992 |
| Molecular Formula | C35H33FN4O2 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-2-(5-hydroxy-1H-indol-3-yl)acetamide |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CC(NC(=O)Cc2c[nH]c3ccc(O)cc23)c2ccccc2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C35H33FN4O2/c1-21-30-20-38-40(27-11-9-26(36)10-12-27)33(30)16-24-8-7-23(35(21)24)15-32(22-5-3-2-4-6-22)39-34(42)17-25-19-37-31-14-13-28(41)18-29(25)31/h2-6,9-14,18-21,23,32,37,41H,7-8,15-17H2,1H3,(H,39,42)/t21-,23+,32?/m0/s1 |
| InChIKey | OGLSELHVTAVGBA-WEZKQISJSA-N |
| XLogP | 7.05 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|