About (4-iminocyclohexa-1,5-dien-1-yl)boronic acid
(4-iminocyclohexa-1,5-dien-1-yl)boronic acid (PubChem CID 68788750) has the molecular formula C6H8BNO2
and a molecular weight of 136.95 g/mol. Its IUPAC name is (4-iminocyclohexa-1,5-dien-1-yl)boronic acid.
Molecular Properties
| Compound Name | (4-iminocyclohexa-1,5-dien-1-yl)boronic acid |
| PubChem CID | 68788750 |
| Molecular Formula | C6H8BNO2 |
| Molecular Weight | 136.95 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | (4-iminocyclohexa-1,5-dien-1-yl)boronic acid |
| SMILES | [H]/N=C1/C=CC(B(O)O)=CC1 |
| InChI | InChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,8-10H,4H2/b8-6- |
| InChIKey | CELZRESKKDEYER-VURMDHGXSA-N |
| XLogP | -0.10 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.95 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-iminocyclohexa-1,5-dien-1-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
The IUPAC name of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid (CID 68788750) is (4-iminocyclohexa-1,5-dien-1-yl)boronic acid.
What is the SMILES notation for (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
The canonical SMILES for (4-iminocyclohexa-1,5-dien-1-yl)boronic acid is [H]/N=C1/C=CC(B(O)O)=CC1.
What is the InChIKey of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
The InChIKey is CELZRESKKDEYER-VURMDHGXSA-N. The full InChI is InChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,8-10H,4H2/b8-6-.
What are the key properties of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
(4-iminocyclohexa-1,5-dien-1-yl)boronic acid has a molecular weight of 136.95 g/mol, XLogP of -0.10, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iminocyclohexa-1,5-dien-1-yl)boronic acid is sourced from PubChem (CID 68788750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).