(4-iminocyclohexa-1,5-dien-1-yl)boronic acid

C6H8BNO2 — CID 68788750

IUPAC(4-iminocyclohexa-1,5-dien-1-yl)boronic acid
SMILES[H]/N=C1/C=CC(B(O)O)=CC1
InChIInChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,8-10H,4H2/b8-6-
InChIKeyCELZRESKKDEYER-VURMDHGXSA-N
MW136.95 g/mol
LogP-0.10
Rot. Bonds1

About (4-iminocyclohexa-1,5-dien-1-yl)boronic acid

(4-iminocyclohexa-1,5-dien-1-yl)boronic acid (PubChem CID 68788750) has the molecular formula C6H8BNO2 and a molecular weight of 136.95 g/mol. Its IUPAC name is (4-iminocyclohexa-1,5-dien-1-yl)boronic acid.

Molecular Properties

Compound Name(4-iminocyclohexa-1,5-dien-1-yl)boronic acid
PubChem CID68788750
Molecular FormulaC6H8BNO2
Molecular Weight136.95 g/mol
Exact Mass137.06
IUPAC Name(4-iminocyclohexa-1,5-dien-1-yl)boronic acid
SMILES[H]/N=C1/C=CC(B(O)O)=CC1
InChIInChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,8-10H,4H2/b8-6-
InChIKeyCELZRESKKDEYER-VURMDHGXSA-N
XLogP-0.10
TPSA64.31 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500136.95
LogP ≤ 5-0.10
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (4-iminocyclohexa-1,5-dien-1-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
The IUPAC name of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid (CID 68788750) is (4-iminocyclohexa-1,5-dien-1-yl)boronic acid.
What is the SMILES notation for (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
The canonical SMILES for (4-iminocyclohexa-1,5-dien-1-yl)boronic acid is [H]/N=C1/C=CC(B(O)O)=CC1.
What is the InChIKey of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
The InChIKey is CELZRESKKDEYER-VURMDHGXSA-N. The full InChI is InChI=1S/C6H8BNO2/c8-6-3-1-5(2-4-6)7(9)10/h1-3,8-10H,4H2/b8-6-.
What are the key properties of (4-iminocyclohexa-1,5-dien-1-yl)boronic acid?
(4-iminocyclohexa-1,5-dien-1-yl)boronic acid has a molecular weight of 136.95 g/mol, XLogP of -0.10, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iminocyclohexa-1,5-dien-1-yl)boronic acid is sourced from PubChem (CID 68788750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).