C38H37FN6O — CID 68789196
3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,1-bis(pyridin-3-ylmethyl)urea (PubChem CID 68789196) has the molecular formula C38H37FN6O and a molecular weight of 612.75 g/mol. Its IUPAC name is 3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,1-bis(pyridin-3-ylmethyl)urea.
| Compound Name | 3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,1-bis(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 68789196 |
| Molecular Formula | C38H37FN6O |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | 3-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,1-bis(pyridin-3-ylmethyl)urea |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CC(NC(=O)N(Cc2cccnc2)Cc2cccnc2)c2ccccc2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C38H37FN6O/c1-26-34-23-42-45(33-15-13-32(39)14-16-33)36(34)20-31-12-11-30(37(26)31)19-35(29-9-3-2-4-10-29)43-38(46)44(24-27-7-5-17-40-21-27)25-28-8-6-18-41-22-28/h2-10,13-18,21-23,26,30,35H,11-12,19-20,24-25H2,1H3,(H,43,46)/t26-,30+,35?/m0/s1 |
| InChIKey | MIDVZALPIUSTIU-VSFLKDGBSA-N |
| XLogP | 7.71 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|