C25H39N3O7 — CID 68789817
ethyl (1S,4R,6S,7E,14S,18R)-18-hydroxy-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 68789817) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is ethyl (1S,4R,6S,7E,14S,18R)-18-hydroxy-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6S,7E,14S,18R)-18-hydroxy-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 68789817 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | ethyl (1S,4R,6S,7E,14S,18R)-18-hydroxy-14-[(2-methylpropan-2-yl)oxycarbonylamino]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C/CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C25H39N3O7/c1-5-34-22(32)25-14-16(25)11-9-7-6-8-10-12-18(26-23(33)35-24(2,3)4)21(31)28-15-17(29)13-19(28)20(30)27-25/h9,11,16-19,29H,5-8,10,12-15H2,1-4H3,(H,26,33)(H,27,30)/b11-9+/t16-,17-,18+,19+,25-/m1/s1 |
| InChIKey | LNACKEHWUDDQJJ-XWABCDATSA-N |
| XLogP | 1.80 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|