C26H27F3N2O4 — CID 68789994
1'-[2-oxo-3-[2-(trifluoromethyl)phenyl]hexanoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid (PubChem CID 68789994) has the molecular formula C26H27F3N2O4 and a molecular weight of 488.51 g/mol. Its IUPAC name is 1'-[2-oxo-3-[2-(trifluoromethyl)phenyl]hexanoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid.
| Compound Name | 1'-[2-oxo-3-[2-(trifluoromethyl)phenyl]hexanoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid |
|---|---|
| PubChem CID | 68789994 |
| Molecular Formula | C26H27F3N2O4 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 1'-[2-oxo-3-[2-(trifluoromethyl)phenyl]hexanoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid |
| SMILES | CCCC(C(=O)C(=O)N1CCC2(CC1)CNc1ccc(C(=O)O)cc12)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3N2O4/c1-2-5-18(17-6-3-4-7-19(17)26(27,28)29)22(32)23(33)31-12-10-25(11-13-31)15-30-21-9-8-16(24(34)35)14-20(21)25/h3-4,6-9,14,18,30H,2,5,10-13,15H2,1H3,(H,34,35) |
| InChIKey | DKQYFWXNCKPGTF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|