C8H10BrClN2 — CID 68790004
3-bromo-2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 68790004) has the molecular formula C8H10BrClN2 and a molecular weight of 249.54 g/mol. Its IUPAC name is 3-bromo-2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 3-bromo-2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 68790004 |
| Molecular Formula | C8H10BrClN2 |
| Molecular Weight | 249.54 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 3-bromo-2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | ClCc1nn2c(c1Br)CCCC2 |
| InChI | InChI=1S/C8H10BrClN2/c9-8-6(5-10)11-12-4-2-1-3-7(8)12/h1-5H2 |
| InChIKey | HOEDBIPRQZNVLG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|