C13H14ClF3N4O4 — CID 68790124
ethyl 2-chloro-3-[(diaminomethylidenehydrazinylidene)methyl]benzoate;2,2,2-trifluoroacetic acid (PubChem CID 68790124) has the molecular formula C13H14ClF3N4O4 and a molecular weight of 382.73 g/mol. Its IUPAC name is ethyl 2-chloro-3-[(diaminomethylidenehydrazinylidene)methyl]benzoate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-chloro-3-[(diaminomethylidenehydrazinylidene)methyl]benzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68790124 |
| Molecular Formula | C13H14ClF3N4O4 |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl 2-chloro-3-[(diaminomethylidenehydrazinylidene)methyl]benzoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1cccc(C=NN=C(N)N)c1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13ClN4O2.C2HF3O2/c1-2-18-10(17)8-5-3-4-7(9(8)12)6-15-16-11(13)14;3-2(4,5)1(6)7/h3-6H,2H2,1H3,(H4,13,14,16);(H,6,7) |
| InChIKey | ZNFMMZZPEWLHMI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|