C26H26N2O2S — CID 68790148
3-benzyl-1,3,4-trimethyl-6-[[2-(5-methylthiophen-2-yl)phenyl]methylidene]piperazine-2,5-dione (PubChem CID 68790148) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 3-benzyl-1,3,4-trimethyl-6-[[2-(5-methylthiophen-2-yl)phenyl]methylidene]piperazine-2,5-dione.
| Compound Name | 3-benzyl-1,3,4-trimethyl-6-[[2-(5-methylthiophen-2-yl)phenyl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 68790148 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-benzyl-1,3,4-trimethyl-6-[[2-(5-methylthiophen-2-yl)phenyl]methylidene]piperazine-2,5-dione |
| SMILES | Cc1ccc(-c2ccccc2C=C2C(=O)N(C)C(C)(Cc3ccccc3)C(=O)N2C)s1 |
| InChI | InChI=1S/C26H26N2O2S/c1-18-14-15-23(31-18)21-13-9-8-12-20(21)16-22-24(29)28(4)26(2,25(30)27(22)3)17-19-10-6-5-7-11-19/h5-16H,17H2,1-4H3 |
| InChIKey | ZOXWBJQWEWWSKB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|