C24H34BN3O2 — CID 68790367
N,N-dimethyl-1-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]methyl]pyrrolidin-3-amine (PubChem CID 68790367) has the molecular formula C24H34BN3O2 and a molecular weight of 407.37 g/mol. Its IUPAC name is N,N-dimethyl-1-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | N,N-dimethyl-1-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 68790367 |
| Molecular Formula | C24H34BN3O2 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N,N-dimethyl-1-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]methyl]pyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(Cc2ccc(-c3cncc(B4OC(C)(C)C(C)(C)O4)c3)cc2)C1 |
| InChI | InChI=1S/C24H34BN3O2/c1-23(2)24(3,4)30-25(29-23)21-13-20(14-26-15-21)19-9-7-18(8-10-19)16-28-12-11-22(17-28)27(5)6/h7-10,13-15,22H,11-12,16-17H2,1-6H3 |
| InChIKey | ZBCHEJKNYYOVGE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|