2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid

C9H9N3O3 — CID 68790453

IUPAC2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid
SMILESNC(=O)C1(C(=O)O)Nc2ccccc2N1
InChIInChI=1S/C9H9N3O3/c10-7(13)9(8(14)15)11-5-3-1-2-4-6(5)12-9/h1-4,11-12H,(H2,10,13)(H,14,15)
InChIKeyZENLPKMZXVHIQY-UHFFFAOYSA-N
MW207.19 g/mol
LogP-0.21
Rot. Bonds2

About 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid

2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid (PubChem CID 68790453) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid.

Molecular Properties

Compound Name2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid
PubChem CID68790453
Molecular FormulaC9H9N3O3
Molecular Weight207.19 g/mol
Exact Mass207.06
IUPAC Name2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid
SMILESNC(=O)C1(C(=O)O)Nc2ccccc2N1
InChIInChI=1S/C9H9N3O3/c10-7(13)9(8(14)15)11-5-3-1-2-4-6(5)12-9/h1-4,11-12H,(H2,10,13)(H,14,15)
InChIKeyZENLPKMZXVHIQY-UHFFFAOYSA-N
XLogP-0.21
TPSA104.45 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.19
LogP ≤ 5-0.21
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid?
The IUPAC name of 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid (CID 68790453) is 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid.
What is the SMILES notation for 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid?
The canonical SMILES for 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid is NC(=O)C1(C(=O)O)Nc2ccccc2N1.
What is the InChIKey of 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid?
The InChIKey is ZENLPKMZXVHIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c10-7(13)9(8(14)15)11-5-3-1-2-4-6(5)12-9/h1-4,11-12H,(H2,10,13)(H,14,15).
What are the key properties of 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid?
2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid has a molecular weight of 207.19 g/mol, XLogP of -0.21, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyl-1,3-dihydrobenzimidazole-2-carboxylic acid is sourced from PubChem (CID 68790453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).