C33H30FN3O3 — CID 68790730
N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 68790730) has the molecular formula C33H30FN3O3 and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 68790730 |
| Molecular Formula | C33H30FN3O3 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[2-[(4R,5R)-1-(4-fluorophenyl)-4-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[f]indazol-5-yl]-1-phenylethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | C[C@@H]1C2=C(CC[C@@H]2CC(NC(=O)c2ccc3c(c2)OCO3)c2ccccc2)Cc2c1cnn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C33H30FN3O3/c1-20-27-18-35-37(26-12-10-25(34)11-13-26)29(27)16-23-8-7-22(32(20)23)15-28(21-5-3-2-4-6-21)36-33(38)24-9-14-30-31(17-24)40-19-39-30/h2-6,9-14,17-18,20,22,28H,7-8,15-16,19H2,1H3,(H,36,38)/t20-,22+,28?/m0/s1 |
| InChIKey | GSVQCQFDKWHABB-FDBSDCMXSA-N |
| XLogP | 6.67 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|