C23H23N3O4S — CID 68790867
2-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4-methylsulfonylbenzonitrile (PubChem CID 68790867) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4-methylsulfonylbenzonitrile.
| Compound Name | 2-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4-methylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 68790867 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[(Z)-(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4-methylsulfonylbenzonitrile |
| SMILES | CN1C(=O)C(C)(Cc2ccccc2)N(C)C(=O)/C1=C/c1cc(S(C)(=O)=O)ccc1C#N |
| InChI | InChI=1S/C23H23N3O4S/c1-23(14-16-8-6-5-7-9-16)22(28)25(2)20(21(27)26(23)3)13-18-12-19(31(4,29)30)11-10-17(18)15-24/h5-13H,14H2,1-4H3/b20-13- |
| InChIKey | VAVJMLZPROLNNW-MOSHPQCFSA-N |
| XLogP | 2.23 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|