About 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one
7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one (PubChem CID 68790896) has the molecular formula C13H14BrNO2
and a molecular weight of 296.16 g/mol. Its IUPAC name is 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| PubChem CID | 68790896 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| SMILES | CC(=O)c1cc2c(cc1Br)C(C)(C)CC(=O)N2 |
| InChI | InChI=1S/C13H14BrNO2/c1-7(16)8-4-11-9(5-10(8)14)13(2,3)6-12(17)15-11/h4-5H,6H2,1-3H3,(H,15,17) |
| InChIKey | VLNBFIABCPDYQL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one?
The IUPAC name of 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one (CID 68790896) is 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one.
What is the SMILES notation for 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one?
The canonical SMILES for 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one is CC(=O)c1cc2c(cc1Br)C(C)(C)CC(=O)N2.
What is the InChIKey of 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one?
The InChIKey is VLNBFIABCPDYQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrNO2/c1-7(16)8-4-11-9(5-10(8)14)13(2,3)6-12(17)15-11/h4-5H,6H2,1-3H3,(H,15,17).
What are the key properties of 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one?
7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one has a molecular weight of 296.16 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-acetyl-6-bromo-4,4-dimethyl-1,3-dihydroquinolin-2-one is sourced from PubChem (CID 68790896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).