C30H54N2O10 — CID 68791161
(Z)-but-2-enedioate;bis((1-ethoxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl) acetate) (PubChem CID 68791161) has the molecular formula C30H54N2O10 and a molecular weight of 602.77 g/mol. Its IUPAC name is (Z)-but-2-enedioate;bis((1-ethoxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl) acetate).
| Compound Name | (Z)-but-2-enedioate;bis((1-ethoxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl) acetate) |
|---|---|
| PubChem CID | 68791161 |
| Molecular Formula | C30H54N2O10 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | (Z)-but-2-enedioate;bis((1-ethoxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl) acetate) |
| SMILES | CCO[NH+]1C(C)(C)CC(OC(C)=O)CC1(C)C.CCO[NH+]1C(C)(C)CC(OC(C)=O)CC1(C)C.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/2C13H25NO3.C4H4O4/c2*1-7-16-14-12(3,4)8-11(17-10(2)15)9-13(14,5)6;5-3(6)1-2-4(7)8/h2*11H,7-9H2,1-6H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | WWOUDTVJFXLQMS-KSBRXOFISA-N |
| XLogP | -0.75 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|