C9H14N2O4 — CID 68791456
(2S)-2-(2,4-dioxoimidazolidin-1-yl)-3,3-dimethylbutanoic acid (PubChem CID 68791456) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2S)-2-(2,4-dioxoimidazolidin-1-yl)-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-(2,4-dioxoimidazolidin-1-yl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 68791456 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2S)-2-(2,4-dioxoimidazolidin-1-yl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@@H](C(=O)O)N1CC(=O)NC1=O |
| InChI | InChI=1S/C9H14N2O4/c1-9(2,3)6(7(13)14)11-4-5(12)10-8(11)15/h6H,4H2,1-3H3,(H,13,14)(H,10,12,15)/t6-/m1/s1 |
| InChIKey | JJVBTNQMJMAERF-ZCFIWIBFSA-N |
| XLogP | 0.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|