About thiophene;trichloro(ethyl)silane
thiophene;trichloro(ethyl)silane (PubChem CID 68791726) has the molecular formula C6H9Cl3SSi
and a molecular weight of 247.65 g/mol. Its IUPAC name is thiophene;trichloro(ethyl)silane.
Molecular Properties
| Compound Name | thiophene;trichloro(ethyl)silane |
| PubChem CID | 68791726 |
| Molecular Formula | C6H9Cl3SSi |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | thiophene;trichloro(ethyl)silane |
| SMILES | CC[Si](Cl)(Cl)Cl.c1ccsc1 |
| InChI | InChI=1S/C4H4S.C2H5Cl3Si/c1-2-4-5-3-1;1-2-6(3,4)5/h1-4H;2H2,1H3 |
| InChIKey | MHEOAIIMXZJFHD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze thiophene;trichloro(ethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene;trichloro(ethyl)silane?
The IUPAC name of thiophene;trichloro(ethyl)silane (CID 68791726) is thiophene;trichloro(ethyl)silane.
What is the SMILES notation for thiophene;trichloro(ethyl)silane?
The canonical SMILES for thiophene;trichloro(ethyl)silane is CC[Si](Cl)(Cl)Cl.c1ccsc1.
What is the InChIKey of thiophene;trichloro(ethyl)silane?
The InChIKey is MHEOAIIMXZJFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4S.C2H5Cl3Si/c1-2-4-5-3-1;1-2-6(3,4)5/h1-4H;2H2,1H3.
What are the key properties of thiophene;trichloro(ethyl)silane?
thiophene;trichloro(ethyl)silane has a molecular weight of 247.65 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene;trichloro(ethyl)silane is sourced from PubChem (CID 68791726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).