About (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol
(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol (PubChem CID 68792130) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol.
Molecular Properties
| Compound Name | (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol |
| PubChem CID | 68792130 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol |
| SMILES | Cn1nc(CO)c2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C11H18N2O/c1-11(2)5-4-8-9(7-14)12-13(3)10(8)6-11/h14H,4-7H2,1-3H3 |
| InChIKey | WLGWOQFRRCVJQT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol?
The IUPAC name of (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol (CID 68792130) is (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol.
What is the SMILES notation for (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol?
The canonical SMILES for (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol is Cn1nc(CO)c2c1CC(C)(C)CC2.
What is the InChIKey of (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol?
The InChIKey is WLGWOQFRRCVJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-11(2)5-4-8-9(7-14)12-13(3)10(8)6-11/h14H,4-7H2,1-3H3.
What are the key properties of (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol?
(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol has a molecular weight of 194.28 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)methanol is sourced from PubChem (CID 68792130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).