About (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol
(1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol (PubChem CID 68792181) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol.
Molecular Properties
| Compound Name | (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol |
| PubChem CID | 68792181 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol |
| SMILES | Cn1nc(CO)c2c1CCC2 |
| InChI | InChI=1S/C8H12N2O/c1-10-8-4-2-3-6(8)7(5-11)9-10/h11H,2-5H2,1H3 |
| InChIKey | GXTQDTXWYDZHAP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol?
The IUPAC name of (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol (CID 68792181) is (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol.
What is the SMILES notation for (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol?
The canonical SMILES for (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol is Cn1nc(CO)c2c1CCC2.
What is the InChIKey of (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol?
The InChIKey is GXTQDTXWYDZHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-10-8-4-2-3-6(8)7(5-11)9-10/h11H,2-5H2,1H3.
What are the key properties of (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol?
(1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol has a molecular weight of 152.20 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methanol is sourced from PubChem (CID 68792181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).