C22H20FN3O2S — CID 6879222
1-[(E)-[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-phenylthiourea (PubChem CID 6879222) has the molecular formula C22H20FN3O2S and a molecular weight of 409.49 g/mol. Its IUPAC name is 1-[(E)-[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 6879222 |
| Molecular Formula | C22H20FN3O2S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-[(E)-[3-[(4-fluorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-3-phenylthiourea |
| SMILES | COc1ccc(/C=N/NC(=S)Nc2ccccc2)cc1COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H20FN3O2S/c1-27-21-12-7-16(13-17(21)15-28-20-10-8-18(23)9-11-20)14-24-26-22(29)25-19-5-3-2-4-6-19/h2-14H,15H2,1H3,(H2,25,26,29)/b24-14+ |
| InChIKey | VIXRIQGAPAYDRJ-ZVHZXABRSA-N |
| XLogP | 4.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|