C38H38N12O4S2 — CID 68792318
1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(1,3,5-trimethylpyrazol-4-yl)hydrazine (PubChem CID 68792318) has the molecular formula C38H38N12O4S2 and a molecular weight of 790.94 g/mol. Its IUPAC name is 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(1,3,5-trimethylpyrazol-4-yl)hydrazine.
| Compound Name | 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(1,3,5-trimethylpyrazol-4-yl)hydrazine |
|---|---|
| PubChem CID | 68792318 |
| Molecular Formula | C38H38N12O4S2 |
| Molecular Weight | 790.94 g/mol |
| Exact Mass | 790.26 |
| IUPAC Name | 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(1,3,5-trimethylpyrazol-4-yl)hydrazine |
| SMILES | Cc1nn(C)c(C)c1N(c1nc2c(-c3ccc(S(C)(=O)=O)cc3)cccn2n1)N(c1nc2c(-c3ccc(S(C)(=O)=O)cc3)cccn2n1)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C38H38N12O4S2/c1-23-33(25(3)45(5)41-23)49(37-39-35-31(11-9-21-47(35)43-37)27-13-17-29(18-14-27)55(7,51)52)50(34-24(2)42-46(6)26(34)4)38-40-36-32(12-10-22-48(36)44-38)28-15-19-30(20-16-28)56(8,53)54/h9-22H,1-8H3 |
| InChIKey | CQVUCHQJYIYXES-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 170.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|