About 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine
1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine (PubChem CID 68792849) has the molecular formula C20H38N4
and a molecular weight of 334.55 g/mol. Its IUPAC name is 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine |
| PubChem CID | 68792849 |
| Molecular Formula | C20H38N4 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCn1cnc(N)n1 |
| InChI | InChI=1S/C20H38N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-19-22-20(21)23-24/h9-10,19H,2-8,11-18H2,1H3,(H2,21,23)/b10-9- |
| InChIKey | SSCWCRSLZICMFR-KTKRTIGZSA-N |
| XLogP | 5.90 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine?
The IUPAC name of 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine (CID 68792849) is 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine?
The canonical SMILES for 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine is CCCCCCCC/C=C\CCCCCCCCn1cnc(N)n1.
What is the InChIKey of 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine?
The InChIKey is SSCWCRSLZICMFR-KTKRTIGZSA-N. The full InChI is InChI=1S/C20H38N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-19-22-20(21)23-24/h9-10,19H,2-8,11-18H2,1H3,(H2,21,23)/b10-9-.
What are the key properties of 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine?
1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine has a molecular weight of 334.55 g/mol, XLogP of 5.90, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-octadec-9-enyl]-1,2,4-triazol-3-amine is sourced from PubChem (CID 68792849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).