C19H23N7O2 — CID 68792912
5-[(2-methoxyethylamino)methyl]-N-(6-methoxy-3-pyridinyl)-3-(4-methyl-1,3,5-triazin-2-yl)pyridin-2-amine (PubChem CID 68792912) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-(6-methoxy-3-pyridinyl)-3-(4-methyl-1,3,5-triazin-2-yl)pyridin-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-(6-methoxy-3-pyridinyl)-3-(4-methyl-1,3,5-triazin-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 68792912 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-(6-methoxy-3-pyridinyl)-3-(4-methyl-1,3,5-triazin-2-yl)pyridin-2-amine |
| SMILES | COCCNCc1cnc(Nc2ccc(OC)nc2)c(-c2ncnc(C)n2)c1 |
| InChI | InChI=1S/C19H23N7O2/c1-13-23-12-24-19(25-13)16-8-14(9-20-6-7-27-2)10-22-18(16)26-15-4-5-17(28-3)21-11-15/h4-5,8,10-12,20H,6-7,9H2,1-3H3,(H,22,26) |
| InChIKey | WETILAUQSSSTCI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|