C22H19F2N3O2 — CID 68793450
2-[(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4,6-difluorobenzonitrile (PubChem CID 68793450) has the molecular formula C22H19F2N3O2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4,6-difluorobenzonitrile.
| Compound Name | 2-[(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 68793450 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[(5-benzyl-1,4,5-trimethyl-3,6-dioxopiperazin-2-ylidene)methyl]-4,6-difluorobenzonitrile |
| SMILES | CN1C(=O)C(C)(Cc2ccccc2)N(C)C(=O)C1=Cc1cc(F)cc(F)c1C#N |
| InChI | InChI=1S/C22H19F2N3O2/c1-22(12-14-7-5-4-6-8-14)21(29)26(2)19(20(28)27(22)3)10-15-9-16(23)11-18(24)17(15)13-25/h4-11H,12H2,1-3H3 |
| InChIKey | ZOTMBORDECRPKM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|