C8H11ClN2 — CID 68793761
2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 68793761) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 68793761 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-(chloromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | ClCc1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C8H11ClN2/c9-6-7-5-8-3-1-2-4-11(8)10-7/h5H,1-4,6H2 |
| InChIKey | QWNDXWFLUYJIMF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|