About 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione
3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione (PubChem CID 68794332) has the molecular formula C22H36O4
and a molecular weight of 364.53 g/mol. Its IUPAC name is 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione.
Molecular Properties
| Compound Name | 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione |
| PubChem CID | 68794332 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione |
| SMILES | C=CCCCCCCCC1(CCCCCCCC=C)OC(=O)COC1=O |
| InChI | InChI=1S/C22H36O4/c1-3-5-7-9-11-13-15-17-22(21(24)25-19-20(23)26-22)18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-19H2 |
| InChIKey | LULRTQDIPNTGHO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione?
The IUPAC name of 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione (CID 68794332) is 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione.
What is the SMILES notation for 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione?
The canonical SMILES for 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione is C=CCCCCCCCC1(CCCCCCCC=C)OC(=O)COC1=O.
What is the InChIKey of 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione?
The InChIKey is LULRTQDIPNTGHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O4/c1-3-5-7-9-11-13-15-17-22(21(24)25-19-20(23)26-22)18-16-14-12-10-8-6-4-2/h3-4H,1-2,5-19H2.
What are the key properties of 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione?
3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione has a molecular weight of 364.53 g/mol, XLogP of 5.66, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(non-8-enyl)-1,4-dioxane-2,5-dione is sourced from PubChem (CID 68794332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).