C37H46BBrN2O6 — CID 68794479
(2-bromo-3-methylcyclohexyl) 1H-indole-6-carboxylate;3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid (PubChem CID 68794479) has the molecular formula C37H46BBrN2O6 and a molecular weight of 705.50 g/mol. Its IUPAC name is (2-bromo-3-methylcyclohexyl) 1H-indole-6-carboxylate;3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid.
| Compound Name | (2-bromo-3-methylcyclohexyl) 1H-indole-6-carboxylate;3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 68794479 |
| Molecular Formula | C37H46BBrN2O6 |
| Molecular Weight | 705.50 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | (2-bromo-3-methylcyclohexyl) 1H-indole-6-carboxylate;3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylic acid |
| SMILES | CC1(C)OB(c2[nH]c3cc(C(=O)O)ccc3c2C2CCCCC2)OC1(C)C.CC1CCCC(OC(=O)c2ccc3cc[nH]c3c2)C1Br |
| InChI | InChI=1S/C21H28BNO4.C16H18BrNO2/c1-20(2)21(3,4)27-22(26-20)18-17(13-8-6-5-7-9-13)15-11-10-14(19(24)25)12-16(15)23-18;1-10-3-2-4-14(15(10)17)20-16(19)12-6-5-11-7-8-18-13(11)9-12/h10-13,23H,5-9H2,1-4H3,(H,24,25);5-10,14-15,18H,2-4H2,1H3 |
| InChIKey | URPJGBDZWZXPNK-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.50 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|