C48H50N12O2 — CID 68794626
1,2-bis[8-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]hydrazine (PubChem CID 68794626) has the molecular formula C48H50N12O2 and a molecular weight of 827.01 g/mol. Its IUPAC name is 1,2-bis[8-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]hydrazine.
| Compound Name | 1,2-bis[8-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 68794626 |
| Molecular Formula | C48H50N12O2 |
| Molecular Weight | 827.01 g/mol |
| Exact Mass | 826.42 |
| IUPAC Name | 1,2-bis[8-(2-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis[3-(4-methylpiperazin-1-yl)phenyl]hydrazine |
| SMILES | COc1ccccc1-c1cccn2nc(N(c3cccc(N4CCN(C)CC4)c3)N(c3cccc(N4CCN(C)CC4)c3)c3nc4c(-c5ccccc5OC)cccn4n3)nc12 |
| InChI | InChI=1S/C48H50N12O2/c1-53-25-29-55(30-26-53)35-13-9-15-37(33-35)59(47-49-45-41(19-11-23-57(45)51-47)39-17-5-7-21-43(39)61-3)60(38-16-10-14-36(34-38)56-31-27-54(2)28-32-56)48-50-46-42(20-12-24-58(46)52-48)40-18-6-8-22-44(40)62-4/h5-24,33-34H,25-32H2,1-4H3 |
| InChIKey | XVTJGBYLKTZRCE-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 98.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.01 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|