About N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide
N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide (PubChem CID 68795382) has the molecular formula C23H18ClNO3
and a molecular weight of 391.85 g/mol. Its IUPAC name is N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide.
Molecular Properties
| Compound Name | N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide |
| PubChem CID | 68795382 |
| Molecular Formula | C23H18ClNO3 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide |
| SMILES | O=C(Cc1ccc2oc3ccccc3c2c1)N[C@@H]1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H18ClNO3/c24-15-6-8-20-18(13-15)19(9-10-27-20)25-23(26)12-14-5-7-22-17(11-14)16-3-1-2-4-21(16)28-22/h1-8,11,13,19H,9-10,12H2,(H,25,26)/t19-/m1/s1 |
| InChIKey | CJINMSNEOZJBEF-LJQANCHMSA-N |
| XLogP | 5.42 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide?
The IUPAC name of N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide (CID 68795382) is N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide.
What is the SMILES notation for N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide?
The canonical SMILES for N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide is O=C(Cc1ccc2oc3ccccc3c2c1)N[C@@H]1CCOc2ccc(Cl)cc21.
What is the InChIKey of N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide?
The InChIKey is CJINMSNEOZJBEF-LJQANCHMSA-N. The full InChI is InChI=1S/C23H18ClNO3/c24-15-6-8-20-18(13-15)19(9-10-27-20)25-23(26)12-14-5-7-22-17(11-14)16-3-1-2-4-21(16)28-22/h1-8,11,13,19H,9-10,12H2,(H,25,26)/t19-/m1/s1.
What are the key properties of N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide?
N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide has a molecular weight of 391.85 g/mol, XLogP of 5.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4R)-6-chloro-3,4-dihydro-2H-chromen-4-yl]-2-dibenzofuran-2-ylacetamide is sourced from PubChem (CID 68795382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).