About (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid
(2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid (PubChem CID 68795430) has the molecular formula C17H19Cl2NO3
and a molecular weight of 356.25 g/mol. Its IUPAC name is (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid |
| PubChem CID | 68795430 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid |
| SMILES | CC1(C[C@H](NC(=O)C2(c3ccc(Cl)cc3Cl)CC2)C(=O)O)CC1 |
| InChI | InChI=1S/C17H19Cl2NO3/c1-16(4-5-16)9-13(14(21)22)20-15(23)17(6-7-17)11-3-2-10(18)8-12(11)19/h2-3,8,13H,4-7,9H2,1H3,(H,20,23)(H,21,22)/t13-/m0/s1 |
| InChIKey | UJPOYIADQNOIKL-ZDUSSCGKSA-N |
| XLogP | 3.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid?
The IUPAC name of (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid (CID 68795430) is (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid.
What is the SMILES notation for (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid?
The canonical SMILES for (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid is CC1(C[C@H](NC(=O)C2(c3ccc(Cl)cc3Cl)CC2)C(=O)O)CC1.
What is the InChIKey of (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid?
The InChIKey is UJPOYIADQNOIKL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H19Cl2NO3/c1-16(4-5-16)9-13(14(21)22)20-15(23)17(6-7-17)11-3-2-10(18)8-12(11)19/h2-3,8,13H,4-7,9H2,1H3,(H,20,23)(H,21,22)/t13-/m0/s1.
What are the key properties of (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid?
(2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid has a molecular weight of 356.25 g/mol, XLogP of 3.78, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[1-(2,4-dichlorophenyl)cyclopropanecarbonyl]amino]-3-(1-methylcyclopropyl)propanoic acid is sourced from PubChem (CID 68795430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).