C40H36N10O4S2 — CID 68795431
1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(2-pyridin-2-ylethyl)hydrazine (PubChem CID 68795431) has the molecular formula C40H36N10O4S2 and a molecular weight of 784.93 g/mol. Its IUPAC name is 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(2-pyridin-2-ylethyl)hydrazine.
| Compound Name | 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(2-pyridin-2-ylethyl)hydrazine |
|---|---|
| PubChem CID | 68795431 |
| Molecular Formula | C40H36N10O4S2 |
| Molecular Weight | 784.93 g/mol |
| Exact Mass | 784.24 |
| IUPAC Name | 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(2-pyridin-2-ylethyl)hydrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cccn3nc(N(CCc4ccccn4)N(CCc4ccccn4)c4nc5c(-c6ccc(S(C)(=O)=O)cc6)cccn5n4)nc23)cc1 |
| InChI | InChI=1S/C40H36N10O4S2/c1-55(51,52)33-17-13-29(14-18-33)35-11-7-25-47-37(35)43-39(45-47)49(27-21-31-9-3-5-23-41-31)50(28-22-32-10-4-6-24-42-32)40-44-38-36(12-8-26-48(38)46-40)30-15-19-34(20-16-30)56(2,53)54/h3-20,23-26H,21-22,27-28H2,1-2H3 |
| InChIKey | ZNLODHDVZHYVKS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 160.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.93 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|