2-amino-5-methylpyrimidine-4-carboxylic acid

C6H7N3O2 — CID 68795502

IUPAC2-amino-5-methylpyrimidine-4-carboxylic acid
SMILESCc1cnc(N)nc1C(=O)O
InChIInChI=1S/C6H7N3O2/c1-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9)
InChIKeyJPPHQMYUSPJLBC-UHFFFAOYSA-N
MW153.14 g/mol
LogP0.07
Rot. Bonds1

About 2-amino-5-methylpyrimidine-4-carboxylic acid

2-amino-5-methylpyrimidine-4-carboxylic acid (PubChem CID 68795502) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is 2-amino-5-methylpyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-5-methylpyrimidine-4-carboxylic acid
PubChem CID68795502
Molecular FormulaC6H7N3O2
Molecular Weight153.14 g/mol
Exact Mass153.05
IUPAC Name2-amino-5-methylpyrimidine-4-carboxylic acid
SMILESCc1cnc(N)nc1C(=O)O
InChIInChI=1S/C6H7N3O2/c1-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9)
InChIKeyJPPHQMYUSPJLBC-UHFFFAOYSA-N
XLogP0.07
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.14
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-5-methylpyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-methylpyrimidine-4-carboxylic acid?
The IUPAC name of 2-amino-5-methylpyrimidine-4-carboxylic acid (CID 68795502) is 2-amino-5-methylpyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-methylpyrimidine-4-carboxylic acid?
The canonical SMILES for 2-amino-5-methylpyrimidine-4-carboxylic acid is Cc1cnc(N)nc1C(=O)O.
What is the InChIKey of 2-amino-5-methylpyrimidine-4-carboxylic acid?
The InChIKey is JPPHQMYUSPJLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c1-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9).
What are the key properties of 2-amino-5-methylpyrimidine-4-carboxylic acid?
2-amino-5-methylpyrimidine-4-carboxylic acid has a molecular weight of 153.14 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-methylpyrimidine-4-carboxylic acid is sourced from PubChem (CID 68795502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).