C11H18N4O6S — CID 68795568
[(4R,6S)-2-oxo-6-(piperidin-4-ylcarbamoyl)-1,3-diazabicyclo[2.2.1]heptan-3-yl] hydrogen sulfate (PubChem CID 68795568) has the molecular formula C11H18N4O6S and a molecular weight of 334.35 g/mol. Its IUPAC name is [(4R,6S)-2-oxo-6-(piperidin-4-ylcarbamoyl)-1,3-diazabicyclo[2.2.1]heptan-3-yl] hydrogen sulfate.
| Compound Name | [(4R,6S)-2-oxo-6-(piperidin-4-ylcarbamoyl)-1,3-diazabicyclo[2.2.1]heptan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 68795568 |
| Molecular Formula | C11H18N4O6S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(4R,6S)-2-oxo-6-(piperidin-4-ylcarbamoyl)-1,3-diazabicyclo[2.2.1]heptan-3-yl] hydrogen sulfate |
| SMILES | O=C(NC1CCNCC1)[C@@H]1C[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H18N4O6S/c16-10(13-7-1-3-12-4-2-7)9-5-8-6-14(9)11(17)15(8)21-22(18,19)20/h7-9,12H,1-6H2,(H,13,16)(H,18,19,20)/t8-,9+/m1/s1 |
| InChIKey | QDPUIUVVBWAQHI-BDAKNGLRSA-N |
| XLogP | -1.53 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|