About 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride
1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride (PubChem CID 68795706) has the molecular formula C20H31Cl2FN6O
and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride |
| PubChem CID | 68795706 |
| Molecular Formula | C20H31Cl2FN6O |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CC(N2CCC(N)CC2)n2c(=O)ccc3ncc(F)cc32)CC1 |
| InChI | InChI=1S/C20H29FN6O.2ClH/c21-14-11-18-17(24-12-14)1-2-20(28)27(18)19(26-9-5-16(23)6-10-26)13-25-7-3-15(22)4-8-25;;/h1-2,11-12,15-16,19H,3-10,13,22-23H2;2*1H |
| InChIKey | OAPRQXSGOVIQDN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride?
The IUPAC name of 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride (CID 68795706) is 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride.
What is the SMILES notation for 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride?
The canonical SMILES for 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride is Cl.Cl.NC1CCN(CC(N2CCC(N)CC2)n2c(=O)ccc3ncc(F)cc32)CC1.
What is the InChIKey of 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride?
The InChIKey is OAPRQXSGOVIQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29FN6O.2ClH/c21-14-11-18-17(24-12-14)1-2-20(28)27(18)19(26-9-5-16(23)6-10-26)13-25-7-3-15(22)4-8-25;;/h1-2,11-12,15-16,19H,3-10,13,22-23H2;2*1H.
What are the key properties of 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride?
1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride has a molecular weight of 461.41 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,2-bis(4-aminopiperidin-1-yl)ethyl]-7-fluoro-1,5-naphthyridin-2-one;dihydrochloride is sourced from PubChem (CID 68795706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).