About 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine
2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine (PubChem CID 68795792) has the molecular formula C20H22F2N6
and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine.
Molecular Properties
| Compound Name | 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine |
| PubChem CID | 68795792 |
| Molecular Formula | C20H22F2N6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine |
| SMILES | Cc1c(CN2CCN(c3cnccn3)C(c3cc(F)ccc3F)C2)cnn1C |
| InChI | InChI=1S/C20H22F2N6/c1-14-15(10-25-26(14)2)12-27-7-8-28(20-11-23-5-6-24-20)19(13-27)17-9-16(21)3-4-18(17)22/h3-6,9-11,19H,7-8,12-13H2,1-2H3 |
| InChIKey | YQOOEZDPOCADDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
The IUPAC name of 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine (CID 68795792) is 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine.
What is the SMILES notation for 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
The canonical SMILES for 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine is Cc1c(CN2CCN(c3cnccn3)C(c3cc(F)ccc3F)C2)cnn1C.
What is the InChIKey of 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
The InChIKey is YQOOEZDPOCADDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N6/c1-14-15(10-25-26(14)2)12-27-7-8-28(20-11-23-5-6-24-20)19(13-27)17-9-16(21)3-4-18(17)22/h3-6,9-11,19H,7-8,12-13H2,1-2H3.
What are the key properties of 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine?
2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine has a molecular weight of 384.43 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-difluorophenyl)-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine is sourced from PubChem (CID 68795792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).