C13H19N3O6S — CID 68795975
(2S)-2-[2-[(3-aminophenyl)methoxycarbonylamino]ethylsulfonylamino]propanoic acid (PubChem CID 68795975) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is (2S)-2-[2-[(3-aminophenyl)methoxycarbonylamino]ethylsulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[2-[(3-aminophenyl)methoxycarbonylamino]ethylsulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 68795975 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2S)-2-[2-[(3-aminophenyl)methoxycarbonylamino]ethylsulfonylamino]propanoic acid |
| SMILES | C[C@H](NS(=O)(=O)CCNC(=O)OCc1cccc(N)c1)C(=O)O |
| InChI | InChI=1S/C13H19N3O6S/c1-9(12(17)18)16-23(20,21)6-5-15-13(19)22-8-10-3-2-4-11(14)7-10/h2-4,7,9,16H,5-6,8,14H2,1H3,(H,15,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | QHZIFNVRHQLMGM-VIFPVBQESA-N |
| XLogP | -0.11 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|