About [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate
[3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68796140) has the molecular formula C24H22Cl2N2O4S
and a molecular weight of 505.42 g/mol. Its IUPAC name is [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| PubChem CID | 68796140 |
| Molecular Formula | C24H22Cl2N2O4S |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | CC1CNCCC1N(C(=O)c1ccc(Cl)cc1Cl)c1cc(-c2ccccc2)sc1OC(=O)O |
| InChI | InChI=1S/C24H22Cl2N2O4S/c1-14-13-27-10-9-19(14)28(22(29)17-8-7-16(25)11-18(17)26)20-12-21(15-5-3-2-4-6-15)33-23(20)32-24(30)31/h2-8,11-12,14,19,27H,9-10,13H2,1H3,(H,30,31) |
| InChIKey | CHQNGDGUWOLKDB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The IUPAC name of [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate (CID 68796140) is [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
What is the SMILES notation for [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The canonical SMILES for [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate is CC1CNCCC1N(C(=O)c1ccc(Cl)cc1Cl)c1cc(-c2ccccc2)sc1OC(=O)O.
What is the InChIKey of [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The InChIKey is CHQNGDGUWOLKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N2O4S/c1-14-13-27-10-9-19(14)28(22(29)17-8-7-16(25)11-18(17)26)20-12-21(15-5-3-2-4-6-15)33-23(20)32-24(30)31/h2-8,11-12,14,19,27H,9-10,13H2,1H3,(H,30,31).
What are the key properties of [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
[3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate has a molecular weight of 505.42 g/mol, XLogP of 6.42, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,4-dichlorobenzoyl)-(3-methylpiperidin-4-yl)amino]-5-phenylthiophen-2-yl] hydrogen carbonate is sourced from PubChem (CID 68796140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).