C46H44N10O6S2 — CID 68796164
1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-morpholin-4-ylphenyl)hydrazine (PubChem CID 68796164) has the molecular formula C46H44N10O6S2 and a molecular weight of 897.06 g/mol. Its IUPAC name is 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-morpholin-4-ylphenyl)hydrazine.
| Compound Name | 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-morpholin-4-ylphenyl)hydrazine |
|---|---|
| PubChem CID | 68796164 |
| Molecular Formula | C46H44N10O6S2 |
| Molecular Weight | 897.06 g/mol |
| Exact Mass | 896.29 |
| IUPAC Name | 1,2-bis[8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1,2-bis(3-morpholin-4-ylphenyl)hydrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cccn3nc(N(c4cccc(N5CCOCC5)c4)N(c4cccc(N5CCOCC5)c4)c4nc5c(-c6ccc(S(C)(=O)=O)cc6)cccn5n4)nc23)cc1 |
| InChI | InChI=1S/C46H44N10O6S2/c1-63(57,58)39-17-13-33(14-18-39)41-11-5-21-53-43(41)47-45(49-53)55(37-9-3-7-35(31-37)51-23-27-61-28-24-51)56(38-10-4-8-36(32-38)52-25-29-62-30-26-52)46-48-44-42(12-6-22-54(44)50-46)34-15-19-40(20-16-34)64(2,59)60/h3-22,31-32H,23-30H2,1-2H3 |
| InChIKey | CMJQYUBMKLDVMS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 160.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.06 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|