C28H40NOP — CID 68796784
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbutyl]-bis(2,6-dimethylphenyl)phosphane (PubChem CID 68796784) has the molecular formula C28H40NOP and a molecular weight of 437.61 g/mol. Its IUPAC name is [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbutyl]-bis(2,6-dimethylphenyl)phosphane.
| Compound Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbutyl]-bis(2,6-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 68796784 |
| Molecular Formula | C28H40NOP |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbutyl]-bis(2,6-dimethylphenyl)phosphane |
| SMILES | CCC(C)(CP(c1c(C)cccc1C)c1c(C)cccc1C)C1=N[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C28H40NOP/c1-10-28(9,26-29-23(17-30-26)27(6,7)8)18-31(24-19(2)13-11-14-20(24)3)25-21(4)15-12-16-22(25)5/h11-16,23H,10,17-18H2,1-9H3/t23-,28?/m1/s1 |
| InChIKey | OEIHSDFBJIVJEV-YFIOFSHDSA-N |
| XLogP | 6.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|