About 3-(1,3-dihydroisoindol-2-yl)phenol
3-(1,3-dihydroisoindol-2-yl)phenol (PubChem CID 687968) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)phenol |
| PubChem CID | 687968 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)phenol |
| SMILES | Oc1cccc(N2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H13NO/c16-14-7-3-6-13(8-14)15-9-11-4-1-2-5-12(11)10-15/h1-8,16H,9-10H2 |
| InChIKey | NDJBHFYAKXHUEI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1,3-dihydroisoindol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dihydroisoindol-2-yl)phenol?
The IUPAC name of 3-(1,3-dihydroisoindol-2-yl)phenol (CID 687968) is 3-(1,3-dihydroisoindol-2-yl)phenol.
What is the SMILES notation for 3-(1,3-dihydroisoindol-2-yl)phenol?
The canonical SMILES for 3-(1,3-dihydroisoindol-2-yl)phenol is Oc1cccc(N2Cc3ccccc3C2)c1.
What is the InChIKey of 3-(1,3-dihydroisoindol-2-yl)phenol?
The InChIKey is NDJBHFYAKXHUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO/c16-14-7-3-6-13(8-14)15-9-11-4-1-2-5-12(11)10-15/h1-8,16H,9-10H2.
What are the key properties of 3-(1,3-dihydroisoindol-2-yl)phenol?
3-(1,3-dihydroisoindol-2-yl)phenol has a molecular weight of 211.26 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dihydroisoindol-2-yl)phenol is sourced from PubChem (CID 687968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).