About [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate
[3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68796973) has the molecular formula C22H19F2NO4S
and a molecular weight of 431.46 g/mol. Its IUPAC name is [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| PubChem CID | 68796973 |
| Molecular Formula | C22H19F2NO4S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | CCCC(=O)N(Cc1ccc(F)cc1F)c1cc(-c2ccccc2)sc1OC(=O)O |
| InChI | InChI=1S/C22H19F2NO4S/c1-2-6-20(26)25(13-15-9-10-16(23)11-17(15)24)18-12-19(14-7-4-3-5-8-14)30-21(18)29-22(27)28/h3-5,7-12H,2,6,13H2,1H3,(H,27,28) |
| InChIKey | GAWLZHZPKBSWAU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The IUPAC name of [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate (CID 68796973) is [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate.
What is the SMILES notation for [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The canonical SMILES for [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate is CCCC(=O)N(Cc1ccc(F)cc1F)c1cc(-c2ccccc2)sc1OC(=O)O.
What is the InChIKey of [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The InChIKey is GAWLZHZPKBSWAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2NO4S/c1-2-6-20(26)25(13-15-9-10-16(23)11-17(15)24)18-12-19(14-7-4-3-5-8-14)30-21(18)29-22(27)28/h3-5,7-12H,2,6,13H2,1H3,(H,27,28).
What are the key properties of [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate?
[3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate has a molecular weight of 431.46 g/mol, XLogP of 6.08, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[butanoyl-[(2,4-difluorophenyl)methyl]amino]-5-phenylthiophen-2-yl] hydrogen carbonate is sourced from PubChem (CID 68796973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).