C21H24N2O — CID 68797002
1-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-diethylethanamine (PubChem CID 68797002) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-diethylethanamine.
| Compound Name | 1-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 68797002 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H24N2O/c1-4-23(5-2)16(3)21-22-19(17-12-8-6-9-13-17)20(24-21)18-14-10-7-11-15-18/h6-16H,4-5H2,1-3H3 |
| InChIKey | WZFZFQFDNUUUCY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |