About [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate
[2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate (PubChem CID 68797097) has the molecular formula C30H45Cl2N3O2
and a molecular weight of 550.62 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate.
Molecular Properties
| Compound Name | [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate |
| PubChem CID | 68797097 |
| Molecular Formula | C30H45Cl2N3O2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate |
| SMILES | CCCN(CCC)CCC(CCN(CCC)CCC)C(=O)Oc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C30H45Cl2N3O2/c1-5-18-34(19-6-2)22-16-24(17-23-35(20-7-3)21-8-4)30(36)37-28-15-10-9-14-27(28)33-29-25(31)12-11-13-26(29)32/h9-15,24,33H,5-8,16-23H2,1-4H3 |
| InChIKey | NFPIOOZUWDMARX-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate?
The IUPAC name of [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate (CID 68797097) is [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate.
What is the SMILES notation for [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate?
The canonical SMILES for [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate is CCCN(CCC)CCC(CCN(CCC)CCC)C(=O)Oc1ccccc1Nc1c(Cl)cccc1Cl.
What is the InChIKey of [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate?
The InChIKey is NFPIOOZUWDMARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H45Cl2N3O2/c1-5-18-34(19-6-2)22-16-24(17-23-35(20-7-3)21-8-4)30(36)37-28-15-10-9-14-27(28)33-29-25(31)12-11-13-26(29)32/h9-15,24,33H,5-8,16-23H2,1-4H3.
What are the key properties of [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate?
[2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate has a molecular weight of 550.62 g/mol, XLogP of 8.28, 18 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dichloroanilino)phenyl] 4-(dipropylamino)-2-[2-(dipropylamino)ethyl]butanoate is sourced from PubChem (CID 68797097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).