C26H27N3O2 — CID 68797872
N-[[4-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)phenyl]methyl]-3-cyano-N-methylbenzamide (PubChem CID 68797872) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[[4-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)phenyl]methyl]-3-cyano-N-methylbenzamide.
| Compound Name | N-[[4-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)phenyl]methyl]-3-cyano-N-methylbenzamide |
|---|---|
| PubChem CID | 68797872 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[[4-(3,4,4a,5,6,7-hexahydro-2H-quinoline-1-carbonyl)phenyl]methyl]-3-cyano-N-methylbenzamide |
| SMILES | CN(Cc1ccc(C(=O)N2CCCC3CCCC=C32)cc1)C(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-28(25(30)23-8-4-6-20(16-23)17-27)18-19-11-13-22(14-12-19)26(31)29-15-5-9-21-7-2-3-10-24(21)29/h4,6,8,10-14,16,21H,2-3,5,7,9,15,18H2,1H3 |
| InChIKey | HBCGHRLDDKRWPC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |