C8H16N2O2 — CID 68798130
2-(oxan-4-yl)ethylurea (PubChem CID 68798130) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(oxan-4-yl)ethylurea.
| Compound Name | 2-(oxan-4-yl)ethylurea |
|---|---|
| PubChem CID | 68798130 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-(oxan-4-yl)ethylurea |
| SMILES | NC(=O)NCCC1CCOCC1 |
| InChI | InChI=1S/C8H16N2O2/c9-8(11)10-4-1-7-2-5-12-6-3-7/h7H,1-6H2,(H3,9,10,11) |
| InChIKey | YHKFHMUMLQWFSR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |