About [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate
[3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate (PubChem CID 68798552) has the molecular formula C17H11F2NO5S2
and a molecular weight of 411.41 g/mol. Its IUPAC name is [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| PubChem CID | 68798552 |
| Molecular Formula | C17H11F2NO5S2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1sc(-c2ccccc2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H11F2NO5S2/c18-11-6-7-15(12(19)8-11)27(23,24)20-13-9-14(10-4-2-1-3-5-10)26-16(13)25-17(21)22/h1-9,20H,(H,21,22) |
| InChIKey | HABPYNBRCRINFN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The IUPAC name of [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate (CID 68798552) is [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate.
What is the SMILES notation for [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The canonical SMILES for [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate is O=C(O)Oc1sc(-c2ccccc2)cc1NS(=O)(=O)c1ccc(F)cc1F.
What is the InChIKey of [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate?
The InChIKey is HABPYNBRCRINFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2NO5S2/c18-11-6-7-15(12(19)8-11)27(23,24)20-13-9-14(10-4-2-1-3-5-10)26-16(13)25-17(21)22/h1-9,20H,(H,21,22).
What are the key properties of [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate?
[3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate has a molecular weight of 411.41 g/mol, XLogP of 4.55, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,4-difluorophenyl)sulfonylamino]-5-phenylthiophen-2-yl] hydrogen carbonate is sourced from PubChem (CID 68798552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).